methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate
methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate structure
|
Common Name | methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 688357-18-8 | Molecular Weight | 238.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate, CAS号688357-18-8, molecular formula C9H7ClN4O2, molecular weight 238.63000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7ClN4O2 |
|---|---|
| Molecular Weight | 238.63000 |
| Exact Mass | 238.02600 |
| PSA | 88.94000 |
| LogP | 2.01196 |
| InChIKey | BMGRQKATPMOPGC-ALCCZGGFSA-N |
| SMILES | COC(=O)C(=Cc1cccnc1Cl)N=[N+]=[N-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:688357-19-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| METHYL(2Z)-2-AZIDO-3-(2-CHLOROPYRIDIN-3-YL)ACRYLATE |
| methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)propyl-2-enoate |
| methyl (2Z)-2-azido-3-[2-chloropyridin-3-yl]prop-2-enoate |
| Methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)prop-2-enoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate have? |
| A: English synonyms of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate: METHYL(2Z)-2-AZIDO-3-(2-CHLOROPYRIDIN-3-YL)ACRYLATE, methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)propyl-2-enoate, methyl (2Z)-2-azido-3-[2-chloropyridin-3-yl]prop-2-enoate, Methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)prop-2-enoate. |
| Q: What is the English name of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: The English name of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate. |
| Q: What are the downstream products of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: Related downstream products(CAS) of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate: 688357-19-9. |
| Q: What is the molecular weight of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: Molecular weight of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is 238.63000. |
| Q: What is the molecular formula of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: Molecular formula of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is C9H7ClN4O2. |
| Q: What is the polar surface area (PSA) of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: Polar surface area (PSA) of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is 88.94000. |
| Q: What is the LogP of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: LogP of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is 2.01196. |
| Q: What is the SMILES notation of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: SMILES notation of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is COC(=O)C(=Cc1cccnc1Cl)N=[N+]=[N-]. |
| Q: What is the Chinese name of 688357-18-8? |
| A: Chinese name of 688357-18-8 is 688357-18-8. |
| Q: What is the CAS number of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate? |
| A: CAS number of methyl (2Z)-2-azido-3-(2-chloropyridin-3-yl)acrylate is 688357-18-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |