2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate
Modify Date: 2026-08-31 23:03:43
2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate structure
|
Common Name | 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 6884-39-5 | Molecular Weight | 244.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20O2 |
|---|---|
| Molecular Weight | 244.33 |
| InChIKey | QNCWGMDWWDAKAP-VAWYXSNFSA-N |
| SMILES | CC(=O)OC=C(C)CC1CCc2ccccc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: SMILES notation of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is CC(=O)OC=C(C)CC1CCc2ccccc2C1. |
| Q: What is the English name of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: The English name of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate. |
| Q: What is the molecular formula of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: Molecular formula of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is C16H20O2. |
| Q: What is the InChIKey of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: InChIKey of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is QNCWGMDWWDAKAP-VAWYXSNFSA-N. |
| Q: What is the Chinese name of 6884-39-5? |
| A: Chinese name of 6884-39-5 is 6884-39-5. |
| Q: What is the CAS number of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: CAS number of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is 6884-39-5. |
| Q: What is the molecular weight of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate? |
| A: Molecular weight of 2-Methyl-3-(1,2,3,4-tetrahydronaphthalen-2-yl)prop-1-en-1-yl acetate is 244.33. |