(acetyloxy-pyridin-2-yl-methyl) acetate structure
|
Common Name | (acetyloxy-pyridin-2-yl-methyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 6885-17-2 | Molecular Weight | 209.19900 | |
| Density | 1.211g/cm3 | Boiling Point | 299.4ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.9ºC | |
| Name | [acetyloxy(pyridin-2-yl)methyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 299.4ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 134.9ºC |
| Exact Mass | 209.06900 |
| PSA | 65.49000 |
| LogP | 1.20640 |
| Index of Refraction | 1.506 |
| InChIKey | DBHMEBUYCVXYKO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccccn1 |
|
~%
(acetyloxy-pyri... CAS#:6885-17-2 |
| Literature: Boekelheide; Linn Journal of the American Chemical Society, 1954 , vol. 76, p. 1286,1289 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| diacetoxy-pyridin-2-yl-methane |
| pyridin-2-ylmethanediyl diacetate |
| 2-diacetoxymethyl-pyridine |
| 2-Diacetoxymethyl-pyridin |