[5-hydroxy-5-(hydroxymethyl)-4-oxo-1-cyclopent-2-enyl] acetate
![[5-hydroxy-5-(hydroxymethyl)-4-oxo-1-cyclopent-2-enyl] acetate Structure](https://image.chemsrc.com/caspic/132/68907-80-2.png)
[5-hydroxy-5-(hydroxymethyl)-4-oxo-1-cyclopent-2-enyl] acetate structure
|
Common Name | [5-hydroxy-5-(hydroxymethyl)-4-oxo-1-cyclopent-2-enyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 68907-80-2 | Molecular Weight | 186.16200 | |
| Density | 1.4g/cm3 | Boiling Point | 339.8ºC at 760 mmHg | |
| Molecular Formula | C8H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
Summary: [5-hydroxy-5-(hydroxymethyl)-4-oxo-1-cyclopent-2-enyl] acetate, also known as [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate, CAS number 68907-80-2, molecular formula C8H10O5, molecular weight 186.16200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 339.8ºC at 760 mmHg |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16200 |
| Flash Point | 139.7ºC |
| Exact Mass | 186.05300 |
| PSA | 83.83000 |
| Index of Refraction | 1.546 |
| InChIKey | AGNRGFRAFJOXHH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C=CC(=O)C1(O)CO |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
![t-4-acetoxy-5-hydroxy-r-5-[[(tert-butyldimethylsilyl)oxy]methyl]-2-cyclopentenone Structure](https://image.chemsrc.com/caspic/417/68882-75-7.png)
CAS#:68882-75-7![6-carbethoxy-1,4-dioxaspiro[4.4]non-6-ene Structure](https://image.chemsrc.com/caspic/426/80963-24-2.png)
CAS#:80963-24-2![1,4-DIOXASPIRO[4.4]NON-6-ENE, 6-BROMO Structure](https://image.chemsrc.com/caspic/093/68241-78-1.png)
CAS#:68241-78-1
CAS#:10481-34-2
CAS#:68882-71-3![2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopent-2-en-1-one Structure](https://image.chemsrc.com/caspic/031/68882-72-4.png)
CAS#:68882-72-4
CAS#:57020-97-0![cis-2,3-dihydroxy-2-[[(tert-butyldimethylsilyl)oxy]methyl]cyclopentanone Structure](https://image.chemsrc.com/caspic/493/68882-73-5.png)
CAS#:68882-73-5![cis-4,5-dihydroxy-5-[[(tert-butyldimethylsilyl)oxy]methyl]-2-cyclopentenone Structure](https://image.chemsrc.com/caspic/455/68882-74-6.png)
CAS#:68882-74-6![t-3-acetoxy-2-hydroxy-r-2-[[(tert-butyldimethylsilyl)oxy]methyl]cyclopentanone Structure](https://image.chemsrc.com/caspic/333/80963-31-1.png)
CAS#:80963-31-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: Related upstream materials(CAS) of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate: 68882-75-7;80963-24-2;68241-78-1;10481-34-2;68882-71-3;68882-72-4;57020-97-0;68882-73-5;68882-74-6;80963-31-1. |
| Q: What is the English name of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: The English name of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate. |
| Q: What is the molecular formula of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: Molecular formula of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is C8H10O5. |
| Q: What is the Chinese name of 68907-80-2? |
| A: Chinese name of 68907-80-2 is 68907-80-2. |
| Q: What is the CAS number of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: CAS number of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is 68907-80-2. |
| Q: What is the InChIKey of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: InChIKey of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is AGNRGFRAFJOXHH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: Molecular weight of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is 186.16200. |
| Q: What is the polar surface area (PSA) of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: Polar surface area (PSA) of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is 83.83000. |
| Q: What is the SMILES notation of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: SMILES notation of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is CC(=O)OC1C=CC(=O)C1(O)CO. |
| Q: What is the boiling point of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate? |
| A: Boiling point of [5-hydroxy-5-(hydroxymethyl)-4-oxocyclopent-2-en-1-yl] acetate is 339.8ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |