triethyl methanetricarboxylate sodium structure
|
Common Name | triethyl methanetricarboxylate sodium | ||
|---|---|---|---|---|
| CAS Number | 68922-87-2 | Molecular Weight | 254.21200 | |
| Density | N/A | Boiling Point | 281.3ºC at 760 mmHg | |
| Molecular Formula | C10H15NaO6 | Melting Point | 196-200ºC(lit.) | |
| MSDS | USA | Flash Point | 118.3ºC | |
| Name | triethyl methanetricarboxylate sodium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 281.3ºC at 760 mmHg |
|---|---|
| Melting Point | 196-200ºC(lit.) |
| Molecular Formula | C10H15NaO6 |
| Molecular Weight | 254.21200 |
| Flash Point | 118.3ºC |
| Exact Mass | 254.07700 |
| PSA | 78.90000 |
| LogP | 0.38370 |
| InChIKey | UKWMITKBVUKHDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)[C-](C(=O)OCC)C(=O)OCC.[Na+] |
| RIDADR | UN 3263 8/PG 2 |
|---|---|
| WGK Germany | 3 |
|
~96%
triethyl methan... CAS#:68922-87-2 |
| Literature: Sylvester, Kevin T.; Chirik, Paul J. Journal of the American Chemical Society, 2009 , vol. 131, # 25 p. 8772 - 8774 |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| methanetricarboxylic acid triethyl ester,sodium-salt |
| 1,1,2-Tricarbethoxy-prop-2-en |
| prop-2-ene-1,1,2-tricarboxylic acid triethyl ester |
| triethyl sodiomethane-1,1,1-tricarboxylate |
| Prop-2-en-1,1,2-tricarbonsaeure-triaethylester |
| Tris(ethoxycarbonyl)methane sodium salt |
| triethyl prop-3-ene-1,1,2-tricarboxylate |
| MFCD00192519 |
| 2-Propene-1,1,2-tricarboxylic acid,triethyl ester |
| triethyl prop-1-ene-2,3,3-tricarboxylate |
| sodium triethyloxycarbonylmethane |
| triethyl methanetricarboxylate sodium salt |
| sodium triethyl methanetricarboxylate |