7-methoxy-3-methyl-3-sulfanylidene-1,2,4,5-tetrahydrobenzo[e]phosphindole structure
|
Common Name | 7-methoxy-3-methyl-3-sulfanylidene-1,2,4,5-tetrahydrobenzo[e]phosphindole | ||
|---|---|---|---|---|
| CAS Number | 68950-74-3 | Molecular Weight | 264.32300 | |
| Density | 1.22g/cm3 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C14H17OPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 7-methoxy-3-methyl-3-sulfanylidene-1,2,4,5-tetrahydrobenzo[e]phosphindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C14H17OPS |
| Molecular Weight | 264.32300 |
| Flash Point | 202.4ºC |
| Exact Mass | 264.07400 |
| PSA | 51.13000 |
| LogP | 4.51610 |
| Index of Refraction | 1.606 |
| InChIKey | OTFXJYYZDUIUAM-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCC1=C2CCP1(C)=S |
|
~%
7-methoxy-3-met... CAS#:68950-74-3 |
| Literature: Symmes,C.; Quin,L.D. Journal of Organic Chemistry, 1979 , vol. 44, p. 1048 - 1056 |
|
~%
7-methoxy-3-met... CAS#:68950-74-3 |
| Literature: Symmes,C.; Quin,L.D. Journal of Organic Chemistry, 1979 , vol. 44, p. 1048 - 1056 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-Methoxy-3-methyl-1,2,4,5-tetrahydro-3H-benzo<e>phosphindol-3-sulfid |