1,2,4,5-Benzenetetracarboxylic acid, mixed 3-chloro-2-hydroxypropyl and γ-ω-perfluoro-C8-14-alkyl esters structure
|
Common Name | 1,2,4,5-Benzenetetracarboxylic acid, mixed 3-chloro-2-hydroxypropyl and γ-ω-perfluoro-C8-14-alkyl esters | ||
|---|---|---|---|---|
| CAS Number | 68954-01-8 | Molecular Weight | 765.90400 | |
| Density | 1.437g/cm3 | Boiling Point | 774.7ºC at 760mmHg | |
| Molecular Formula | C28H33Cl3F6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 422.3ºC | |
| Name | 5-[3-chloro-2-(4,4,5,5,6,6-hexafluorononoxy)propoxy]carbonyl-2,4-bis[(3-chloro-2-hydroxypropoxy)carbonyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 774.7ºC at 760mmHg |
| Molecular Formula | C28H33Cl3F6O11 |
| Molecular Weight | 765.90400 |
| Flash Point | 422.3ºC |
| Exact Mass | 764.09900 |
| PSA | 165.89000 |
| LogP | 5.16480 |
| Index of Refraction | 1.505 |
| InChIKey | KVXVLCBFSKMBAR-UHFFFAOYSA-N |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)CCCOC(CCl)COC(=O)c1cc(C(=O)O)c(C(=O)OCC(O)CCl)cc1C(=O)OCC(O)CCl |
| einecs 273-236-7 |