2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol,carbonic acid,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol,carbonic acid,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 68958-04-3 | Molecular Weight | 638.74600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H42O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol,carbonic acid,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C39H42O8 |
|---|---|
| Molecular Weight | 638.74600 |
| Exact Mass | 638.28800 |
| PSA | 158.68000 |
| LogP | 8.55630 |
| InChIKey | LRWGRNRPBKDTNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.Cc1ccc(O)c(Cc2cc(C)cc(Cc3cc(C)ccc3O)c2O)c1.O=C(O)O |
| 2,6-Bis((2-hydroxy-5-methylphenyl)methyl)-4-methylphenol carbonate,bisphenol A polymer |
| Carbonic acid,polymer with 2,6-bis((2-hydroxy-5-methylphenyl)methyl)-4-methylphenol and 4,4'-(1-methylethylidene)bis(phenol) |