1,1,2,2-tetrakis(2-methylpropyl)hydrazine structure
|
Common Name | 1,1,2,2-tetrakis(2-methylpropyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 68970-07-0 | Molecular Weight | 256.47000 | |
| Density | 0.83g/cm3 | Boiling Point | 307.6ºC at 760mmHg | |
| Molecular Formula | C16H36N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.8ºC | |
| Name | 1,1,2,2-tetrakis(2-methylpropyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.83g/cm3 |
|---|---|
| Boiling Point | 307.6ºC at 760mmHg |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.47000 |
| Flash Point | 118.8ºC |
| Exact Mass | 256.28800 |
| PSA | 6.48000 |
| LogP | 4.12940 |
| Index of Refraction | 1.453 |
| InChIKey | GSONUQXEKJVKPC-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)N(CC(C)C)CC(C)C |
|
~38%
1,1,2,2-tetraki... CAS#:68970-07-0 |
| Literature: Clennan, E. L.; Noe, L. J; Szneler, E.; Wen, T. Journal of the American Chemical Society, 1990 , vol. 112, # 13 p. 5080 - 5085 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hydrazine,tetraisobutyl |
| tetraisobutylhydrazine |
| N,N'-Diisobutyl-hydrazin |