N-(4-methylphenyl)sulfonyl-N-phenyl-formamide structure
|
Common Name | N-(4-methylphenyl)sulfonyl-N-phenyl-formamide | ||
|---|---|---|---|---|
| CAS Number | 68984-88-3 | Molecular Weight | 275.32300 | |
| Density | 1.306g/cm3 | Boiling Point | 426.8ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | N-(4-methylphenyl)sulfonyl-N-phenylformamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 426.8ºC at 760 mmHg |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.32300 |
| Flash Point | 211.9ºC |
| Exact Mass | 275.06200 |
| PSA | 62.83000 |
| LogP | 4.06340 |
| Index of Refraction | 1.617 |
| InChIKey | XSRVKLJZAXSDQG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C=O)c2ccccc2)cc1 |
|
~99%
N-(4-methylphen... CAS#:68984-88-3 |
| Literature: Brueckner, David Tetrahedron, 2006 , vol. 62, # 16 p. 3809 - 3814 |
|
~%
N-(4-methylphen... CAS#:68984-88-3 |
| Literature: Clavier, Herve; Lepronier, Aymeric; Bengobesse-Mintsa, Nathalie; Gatineau, David; Pellissier, Helene; Giordano, Laurent; Tenaglia, Alphonse; Buono, Gerard Advanced Synthesis and Catalysis, 2013 , vol. 355, # 2-3 p. 403 - 408 |
|
~%
N-(4-methylphen... CAS#:68984-88-3 |
| Literature: Clavier, Herve; Lepronier, Aymeric; Bengobesse-Mintsa, Nathalie; Gatineau, David; Pellissier, Helene; Giordano, Laurent; Tenaglia, Alphonse; Buono, Gerard Advanced Synthesis and Catalysis, 2013 , vol. 355, # 2-3 p. 403 - 408 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(4-METHYLPHENYL)SULFONYL-N-PHENYL-FORMAMIDE |
| N-Phenyl-N-p-toluensulfonylformamid |
| N-Formyl-N-phenyl-4-methyl-benzenesulfonamide |
| N-phenyl-N-tosylformamide |