tris[(2-methylpropan-2-yl)oxy]-sulfanylsilane structure
|
Common Name | tris[(2-methylpropan-2-yl)oxy]-sulfanylsilane | ||
|---|---|---|---|---|
| CAS Number | 690-52-8 | Molecular Weight | 280.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H28O3SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris[(2-methylpropan-2-yl)oxy]-sulfanylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H28O3SSi |
|---|---|
| Molecular Weight | 280.49900 |
| Exact Mass | 280.15300 |
| PSA | 66.49000 |
| LogP | 3.79710 |
| InChIKey | ZVUGYOCGLCLJAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Si](S)(OC(C)(C)C)OC(C)(C)C |
|
~4%
tris[(2-methylp... CAS#:690-52-8 |
| Literature: Cai, Yudong; Roberts, Brian P. Tetrahedron Letters, 2001 , vol. 42, # 4 p. 763 - 766 |
|
~30%
tris[(2-methylp... CAS#:690-52-8 |
| Literature: Dang; Roberts; Tocher Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 19 p. 2452 - 2461 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| tri-t-butoxysilathiol |
| tri-tert-butyloxysilanethiol |
| tri-tert-butoxysilanethiol |
| Tris<t-butoxy>silylthiol |