(15R)-12-Hydroxy-15-methyllycopodan-5-one structure
|
Common Name | (15R)-12-Hydroxy-15-methyllycopodan-5-one | ||
|---|---|---|---|---|
| CAS Number | 6900-92-1 | Molecular Weight | 263.375 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 412.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4±28.7 °C | |
Use of (15R)-12-Hydroxy-15-methyllycopodan-5-oneLycodoline is a alkaloid with butyrylcholinesterase (BChE) (IC50 of 667 μM) inhibition activities[1]. |
| Name | Lycodoline |
|---|---|
| Synonym | More Synonyms |
| Description | Lycodoline is a alkaloid with butyrylcholinesterase (BChE) (IC50 of 667 μM) inhibition activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.7±45.0 °C at 760 mmHg |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.375 |
| Flash Point | 203.4±28.7 °C |
| Exact Mass | 263.188538 |
| PSA | 40.54000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | DBMXKPOCXQNWOQ-WALBABNVSA-N |
| SMILES | CC1CC2CC(=O)C3CCCN4CCCC2(O)C34C1 |
| (15R)-12-Hydroxy-15-methyllycopodan-5-one |
| 4-Hydroxy-lycopodin |