[2R,(-)]-2,3-Dihydro-4,8-dimethoxy-9-methyl-2-(1-methylethyl)furo[2,3-b]quinolinium structure
|
Common Name | [2R,(-)]-2,3-Dihydro-4,8-dimethoxy-9-methyl-2-(1-methylethyl)furo[2,3-b]quinolinium | ||
|---|---|---|---|---|
| CAS Number | 6901-22-0 | Molecular Weight | 288.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22NO3 |
|---|---|
| Molecular Weight | 288.36100 |
| Exact Mass | 288.16000 |
| PSA | 40.46000 |
| LogP | 2.67210 |
| InChIKey | GUIBZZYABLMRRD-CQSZACIVSA-N |
| SMILES | COc1c2c([n+](C)c3c(OC)cccc13)OC(C(C)C)C2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Lunasine [MI] |
| LUNASINE |
| UNII-80R70AS7M1 |
| FURO(2,3-b)quinolinium,2,3-dihydro-4,8-dimethoxy-9-methyl-2-(1-methylethyl)-,(2R) |
| Lunasin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: The English name of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium. |
| Q: What English synonyms does (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium have? |
| A: English synonyms of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium: Lunasine [MI], LUNASINE, UNII-80R70AS7M1, FURO(2,3-b)quinolinium,2,3-dihydro-4,8-dimethoxy-9-methyl-2-(1-methylethyl)-,(2R), Lunasin. |
| Q: What is the InChIKey of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: InChIKey of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is GUIBZZYABLMRRD-CQSZACIVSA-N. |
| Q: What is the LogP of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: LogP of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is 2.67210. |
| Q: What is the CAS number of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: CAS number of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is 6901-22-0. |
| Q: What is the molecular formula of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: Molecular formula of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is C17H22NO3. |
| Q: What is the polar surface area (PSA) of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: Polar surface area (PSA) of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is 40.46000. |
| Q: What is the molecular weight of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: Molecular weight of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is 288.36100. |
| Q: What is the SMILES notation of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium? |
| A: SMILES notation of (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium is COc1c2c([n+](C)c3c(OC)cccc13)OC(C(C)C)C2. |
| Q: What is the Chinese name of 6901-22-0? |
| A: Chinese name of 6901-22-0 is 6901-22-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |