N-hydroxysuccinimide ester of 4-(tert-butoxycarbonylamino)butyric acid structure
|
Common Name | N-hydroxysuccinimide ester of 4-(tert-butoxycarbonylamino)butyric acid | ||
|---|---|---|---|---|
| CAS Number | 69038-04-6 | Molecular Weight | 300.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-hydroxysuccinimide ester of 4-(tert-butoxycarbonylamino)butyric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20N2O6 |
|---|---|
| Molecular Weight | 300.30800 |
| Exact Mass | 300.13200 |
| PSA | 102.01000 |
| LogP | 1.22730 |
| InChIKey | FZHPNVGBJRBWRE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)ON1C(=O)CCC1=O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Boc-Gaba-OSu |
| 4-tert-butoxycarbonylaminobutyric acid 2,5-dioxopyrrolidin-1-yl ester |
| N-Boc-γ-aminobutyric acid N-hydroxysuccinimide ester |
| 2,5-dioxopyrrolidin-1-yl 4-[(tert-butoxycabronyl)amino]butyrate |
| N-Boc-4-aminobutyric acid succinimidyl ester |
| 4-tert-butyloxycarbonylaminobutanoic acid succinimidyl ester |