1,3,3,5,5,7-hexamethyl-1,1,7,7-tetraphenyltetrasiloxane structure
|
Common Name | 1,3,3,5,5,7-hexamethyl-1,1,7,7-tetraphenyltetrasiloxane | ||
|---|---|---|---|---|
| CAS Number | 6904-66-1 | Molecular Weight | 558.96300 | |
| Density | 1.06g/cm3 | Boiling Point | 522.5ºC at 760 mmHg | |
| Molecular Formula | C30H38O3Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | [dimethyl-[methyl(diphenyl)silyl]oxysilyl]oxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 522.5ºC at 760 mmHg |
| Molecular Formula | C30H38O3Si4 |
| Molecular Weight | 558.96300 |
| Flash Point | 226.8ºC |
| Exact Mass | 558.19000 |
| PSA | 27.69000 |
| LogP | 5.21920 |
| Index of Refraction | 1.555 |
| InChIKey | HNGWDEQHOJWGBN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O[Si](C)(C)O[Si](C)(c1ccccc1)c1ccccc1)O[Si](C)(c1ccccc1)c1ccccc1 |
| HS Code | 2934999090 |
|---|
|
~%
1,3,3,5,5,7-hex... CAS#:6904-66-1 |
| Literature: Bazant; Benes Collection of Czechoslovak Chemical Communications, 1959 , vol. 24, p. 624,626 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,3,5,5,7-Hexamethyl-1,1,7,7-tetraphenyltetrasiloxane |
| 1,3,3,5,5,7-Hexamethyl-1,1,7,7,-tetraphenyl-tetrasiloxan |
| Tetrasiloxane,1,3,3,5,5,7-hexamethyl-1,1,7,7-tetraphenyl |
| EINECS 230-013-9 |