2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine
Modify Date: 2026-08-13 20:28:47
2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine structure
|
Common Name | 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 69045-89-2 | Molecular Weight | 289.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7ClF3NO2 |
|---|---|
| Molecular Weight | 289.63800 |
| Exact Mass | 289.01200 |
| PSA | 42.35000 |
| LogP | 4.25170 |
| InChIKey | NMJNUBBLJFJUKE-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-((3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenol |
| 3-chloro-2-p-hydroxyphenoxy-5-trifluoromethylpyridine |
| 4-(3'-chloro-5'-trifluoromethyl-2'-pyridyloxy)phenol |
| 4-(3-chloro-5-trifluoromethyl-pyridin-2-yloxy)phenol |
| 4-(3-chloro-5-(trifluoromethyl)pyridin-2-yloxy)phenol |
| 2-(4-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: CAS number of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is 69045-89-2. |
| Q: What is the LogP of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: LogP of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is 4.25170. |
| Q: What is the English name of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: The English name of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine. |
| Q: What is the InChIKey of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: InChIKey of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is NMJNUBBLJFJUKE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: Polar surface area (PSA) of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is 42.35000. |
| Q: What is the SMILES notation of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: SMILES notation of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1. |
| Q: What is the Chinese name of 69045-89-2? |
| A: Chinese name of 69045-89-2 is 69045-89-2. |
| Q: What is the molecular weight of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: Molecular weight of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is 289.63800. |
| Q: What English synonyms does 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine have? |
| A: English synonyms of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine: 4-((3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenol, 3-chloro-2-p-hydroxyphenoxy-5-trifluoromethylpyridine, 4-(3'-chloro-5'-trifluoromethyl-2'-pyridyloxy)phenol, 4-(3-chloro-5-trifluoromethyl-pyridin-2-yloxy)phenol, 4-(3-chloro-5-(trifluoromethyl)pyridin-2-yloxy)phenol, 2-(4-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine. |
| Q: What is the molecular formula of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine? |
| A: Molecular formula of 2-(4'-hydroxyphenoxy)-3-chloro-5-trifluoromethylpyridine is C12H7ClF3NO2. |