butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate
Modify Date: 2026-06-22 11:55:01
![butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate Structure](https://www.chemsrc.com/extcaspic/209/690688-52-9.png)
butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate structure
|
Common Name | butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate | ||
|---|---|---|---|---|
| CAS Number | 690688-52-9 | Molecular Weight | 365.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H19NO5 |
|---|---|
| Molecular Weight | 365.4 |
| InChIKey | BOPFRMKRYFLYTI-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC(=O)C3=CC=CC=C3O2 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 43, Current Page 1 of 5
1
2
3
4
5
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: InChIKey of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is BOPFRMKRYFLYTI-UHFFFAOYSA-N. |
| Q: What is the English name of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: The English name of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate. |
| Q: What is the molecular weight of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: Molecular weight of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is 365.4. |
| Q: What is the molecular formula of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: Molecular formula of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is C21H19NO5. |
| Q: What is the SMILES notation of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: SMILES notation of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is CCCCOC(=O)C1=CC=C(C=C1)NC(=O)C2=CC(=O)C3=CC=CC=C3O2. |
| Q: What is the Chinese name of 690688-52-9? |
| A: Chinese name of 690688-52-9 is 690688-52-9. |
| Q: What is the CAS number of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate? |
| A: CAS number of butyl 4-{[(4-oxo-4H-chromen-2-yl)carbonyl]amino}benzoate is 690688-52-9. |