2-azido-5-nitropyridine
2-azido-5-nitropyridine structure
|
Common Name | 2-azido-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 69080-06-4 | Molecular Weight | 165.11000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-azido-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H3N5O2 |
|---|---|
| Molecular Weight | 165.11000 |
| Exact Mass | 165.02900 |
| PSA | 108.46000 |
| LogP | 1.90756 |
| InChIKey | TUQUNZYKJDZNFV-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc([N+](=O)[O-])cn1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:4318-76-7![3-nitro-1,7,8,9-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene structure](https://image.chemsrc.com/caspic/027/35235-73-5.png)
CAS#:35235-73-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-azido-5-nitro-pyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-azido-5-nitropyridine? |
| A: Molecular formula of 2-azido-5-nitropyridine is C5H3N5O2. |
| Q: What is the InChIKey of 2-azido-5-nitropyridine? |
| A: InChIKey of 2-azido-5-nitropyridine is TUQUNZYKJDZNFV-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2-azido-5-nitropyridine? |
| A: Related downstream products(CAS) of 2-azido-5-nitropyridine: 4318-76-7;35235-73-5. |
| Q: What is the polar surface area (PSA) of 2-azido-5-nitropyridine? |
| A: Polar surface area (PSA) of 2-azido-5-nitropyridine is 108.46000. |
| Q: What is the LogP of 2-azido-5-nitropyridine? |
| A: LogP of 2-azido-5-nitropyridine is 1.90756. |
| Q: What is the English name of 2-azido-5-nitropyridine? |
| A: The English name of 2-azido-5-nitropyridine is 2-azido-5-nitropyridine. |
| Q: What English synonyms does 2-azido-5-nitropyridine have? |
| A: English synonyms of 2-azido-5-nitropyridine: 2-azido-5-nitro-pyridine. |
| Q: What is the SMILES notation of 2-azido-5-nitropyridine? |
| A: SMILES notation of 2-azido-5-nitropyridine is [N-]=[N+]=Nc1ccc([N+](=O)[O-])cn1. |
| Q: What is the CAS number of 2-azido-5-nitropyridine? |
| A: CAS number of 2-azido-5-nitropyridine is 69080-06-4. |
| Q: What is the molecular weight of 2-azido-5-nitropyridine? |
| A: Molecular weight of 2-azido-5-nitropyridine is 165.11000. |