2-[2,4-bis(1,1-Dimethylpropyl) phenoxy] butyric acid ethyl ester
![2-[2,4-bis(1,1-Dimethylpropyl) phenoxy] butyric acid ethyl ester Structure](https://image.chemsrc.com/caspic/308/69080-71-3.png)
2-[2,4-bis(1,1-Dimethylpropyl) phenoxy] butyric acid ethyl ester structure
|
Common Name | 2-[2,4-bis(1,1-Dimethylpropyl) phenoxy] butyric acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 69080-71-3 | Molecular Weight | 348.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H36O3 |
|---|---|
| Molecular Weight | 348.51900 |
| Exact Mass | 348.26600 |
| PSA | 35.53000 |
| LogP | 5.78230 |
| InChIKey | JKRQFHMFCWYGHW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
2-[2,4-bis(1,1-... CAS#:69080-71-3 |
| Literature: Sumitomo Chemical Company, Limited Patent: US5442114 A1, 1995 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:13403-01-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: Related downstream products(CAS) of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate: 13403-01-5. |
| Q: What is the polar surface area (PSA) of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: Polar surface area (PSA) of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is 35.53000. |
| Q: What is the LogP of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: LogP of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is 5.78230. |
| Q: What is the CAS number of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: CAS number of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is 69080-71-3. |
| Q: What is the SMILES notation of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: SMILES notation of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is CCOC(=O)C(CC)Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC. |
| Q: What are the upstream materials of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: Related upstream materials(CAS) of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate: 120-95-6;533-68-6. |
| Q: What is the molecular weight of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: Molecular weight of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is 348.51900. |
| Q: What is the English name of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: The English name of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate. |
| Q: What is the molecular formula of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: Molecular formula of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is C22H36O3. |
| Q: What is the InChIKey of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate? |
| A: InChIKey of ethyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoate is JKRQFHMFCWYGHW-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |