3-methyl-10-phenylpyrimido[4,5-b]quinoline-2,4-dione structure
|
Common Name | 3-methyl-10-phenylpyrimido[4,5-b]quinoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 69083-37-0 | Molecular Weight | 303.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-10-phenylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H13N3O2 |
|---|---|
| Molecular Weight | 303.31500 |
| Exact Mass | 303.10100 |
| PSA | 56.89000 |
| LogP | 2.23760 |
| InChIKey | MXTACMPGPLXHPG-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)nc2n(-c3ccccc3)c3ccccc3cc-2c1=O |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition of rat brain protein kinase C
Source: ChEMBL
Target: Protein kinase C theta type
External Id: CHEMBL970837
|
|
Name: Growth inhibition of human KB cells by MTT assay
Source: ChEMBL
Target: KB
External Id: CHEMBL970838
|
| 3-methyl-10-phenyl-5-deazaflavin |
| 3-methyl-10-phenyl-5-deazaisoalloxazine |