4-(1-chloropentylsulfonyl)morpholine
4-(1-chloropentylsulfonyl)morpholine structure
|
Common Name | 4-(1-chloropentylsulfonyl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 69083-63-2 | Molecular Weight | 255.76200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(1-Chloropentylsulfonyl)morpholine (CAS: 69083-63-2), molecular formula: C9H18ClNO3S, molecular weight: 255.76200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1-chloropentylsulfonyl)morpholine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H18ClNO3S |
|---|---|
| Molecular Weight | 255.76200 |
| Exact Mass | 255.07000 |
| PSA | 54.99000 |
| LogP | 2.42220 |
| InChIKey | HTUXRLOSVWSRBN-UHFFFAOYSA-N |
| SMILES | CCCCC(Cl)S(=O)(=O)N1CCOCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(1-chloropent... CAS#:69083-63-2 |
| Literature: Golinski,J.; Makosza,M. Synthesis, 1978 , p. 823 - 825 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![4-[1-(4-nitrophenyl)pentylsulfonyl]morpholine structure](https://image.chemsrc.com/caspic/248/89303-58-2.png)
CAS#:89303-58-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-chloropentyl 4-morpholinyl sulfone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 4-(1-chloropentylsulfonyl)morpholine? |
| A: Related upstream materials(CAS) of 4-(1-chloropentylsulfonyl)morpholine: 109-65-9;39542-27-3. |
| Q: What are the downstream products of 4-(1-chloropentylsulfonyl)morpholine? |
| A: Related downstream products(CAS) of 4-(1-chloropentylsulfonyl)morpholine: 89303-58-2. |
| Q: What English synonyms does 4-(1-chloropentylsulfonyl)morpholine have? |
| A: English synonyms of 4-(1-chloropentylsulfonyl)morpholine: 1-chloropentyl 4-morpholinyl sulfone. |
| Q: What is the CAS number of 4-(1-chloropentylsulfonyl)morpholine? |
| A: CAS number of 4-(1-chloropentylsulfonyl)morpholine is 69083-63-2. |
| Q: What is the English name of 4-(1-chloropentylsulfonyl)morpholine? |
| A: The English name of 4-(1-chloropentylsulfonyl)morpholine is 4-(1-chloropentylsulfonyl)morpholine. |
| Q: What is the molecular weight of 4-(1-chloropentylsulfonyl)morpholine? |
| A: Molecular weight of 4-(1-chloropentylsulfonyl)morpholine is 255.76200. |
| Q: What is the Chinese name of 69083-63-2? |
| A: Chinese name of 69083-63-2 is 69083-63-2. |
| Q: What is the SMILES notation of 4-(1-chloropentylsulfonyl)morpholine? |
| A: SMILES notation of 4-(1-chloropentylsulfonyl)morpholine is CCCCC(Cl)S(=O)(=O)N1CCOCC1. |
| Q: What is the LogP of 4-(1-chloropentylsulfonyl)morpholine? |
| A: LogP of 4-(1-chloropentylsulfonyl)morpholine is 2.42220. |
| Q: What is the polar surface area (PSA) of 4-(1-chloropentylsulfonyl)morpholine? |
| A: Polar surface area (PSA) of 4-(1-chloropentylsulfonyl)morpholine is 54.99000. |