3-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]pyrrole-2,5-dione structure
|
Common Name | 3-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 69100-09-0 | Molecular Weight | 339.08400 | |
| Density | 2.169g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C9H10INO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | 3-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.169g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C9H10INO5 |
| Molecular Weight | 339.08400 |
| Flash Point | 294.2ºC |
| Exact Mass | 338.96000 |
| PSA | 95.86000 |
| Index of Refraction | 1.702 |
| InChIKey | OWTVGTZCOYEUQF-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C2OC(CI)C(O)C2O)C(=O)N1 |
|
~%
3-[3,4-dihydrox... CAS#:69100-09-0 |
| Literature: Earl; Townsend Journal of Carbohydrates Nucleosides Nucleotides, 1978 , vol. 5, # 4 p. 305 - 315 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5'-iodo-5'-deoxy-showdomycin |