1-[3-methoxy-4-(oxiran-2-ylmethoxy)phenyl]ethanone structure
|
Common Name | 1-[3-methoxy-4-(oxiran-2-ylmethoxy)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 69114-02-9 | Molecular Weight | 222.23700 | |
| Density | 1.174g/cm3 | Boiling Point | 356.3ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.6ºC | |
| Name | 1-[3-methoxy-4-(oxiran-2-ylmethoxy)phenyl]ethanone |
|---|
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 356.3ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 158.6ºC |
| Exact Mass | 222.08900 |
| PSA | 48.06000 |
| LogP | 1.67540 |
| Index of Refraction | 1.53 |
| InChIKey | SEIIAIINWYFXFL-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)=O)ccc1OCC1CO1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |