Adenylyl-(5'.2')-guanosine structure
|
Common Name | Adenylyl-(5'.2')-guanosine | ||
|---|---|---|---|---|
| CAS Number | 6918-37-2 | Molecular Weight | 237.29600 | |
| Density | 2.41g/cm3 | Boiling Point | 1147.4ºC at 760 mmHg | |
| Molecular Formula | C16H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 647.7ºC | |
| Name | (E)-N-(4-methylphenyl)-3-phenylprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.41g/cm3 |
|---|---|
| Boiling Point | 1147.4ºC at 760 mmHg |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.29600 |
| Flash Point | 647.7ºC |
| Exact Mass | 237.11500 |
| PSA | 29.10000 |
| LogP | 3.71990 |
| Index of Refraction | 2.013 |
| InChIKey | ZLNKIMYMVZHDPX-INFSMZHSSA-N |
| SMILES | Nc1nc2c(ncn2C2OC(CO)C(O)C2OP(=O)(O)OCC2OC(n3cnc4c(N)ncnc43)C(O)C2O)c(=O)[nH]1 |
|
~%
Adenylyl-(5'.2'... CAS#:6918-37-2 |
| Literature: Michelson Journal of the Chemical Society, 1959 , p. 3655,3664,3666 Biochemical Preparations, 1963 , vol. 10, p. 131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-P-Tolylcinnamamide |
| Guanylyl-2'-5'-adenosin |