2-phenyl-1-thiophen-2-ylcycloprop-2-ene-1-carboxylic acid structure
|
Common Name | 2-phenyl-1-thiophen-2-ylcycloprop-2-ene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 691889-40-4 | Molecular Weight | 242.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenyl-1-thiophen-2-ylcycloprop-2-ene-1-carboxylic acid |
|---|
| Molecular Formula | C14H10O2S |
|---|---|
| Molecular Weight | 242.29300 |
| Exact Mass | 242.04000 |
| PSA | 65.54000 |
| LogP | 3.16770 |
| InChIKey | KYLZTKUWXPQGET-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2cccs2)C=C1c1ccccc1 |
|
~%
2-phenyl-1-thio... CAS#:691889-40-4 |
| Literature: Liao, Lian-An; Zhang, Fan; Dmitrenko, Olga; Bach, Robert D.; Fox, Joseph M. Journal of the American Chemical Society, 2004 , vol. 126, # 14 p. 4490 - 4491 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |