1-cyclobutyl-4-nitrobenzene structure
|
Common Name | 1-cyclobutyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 6921-49-9 | Molecular Weight | 177.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclobutyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO2 |
|---|---|
| Molecular Weight | 177.20000 |
| Exact Mass | 177.07900 |
| PSA | 45.82000 |
| LogP | 3.38550 |
| InChIKey | KLBFSIVMPHEWFC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2CCC2)cc1 |
|
~%
1-cyclobutyl-4-... CAS#:6921-49-9 |
| Literature: Hahn,R.C. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 3404 - 3415 |
|
~%
1-cyclobutyl-4-... CAS#:6921-49-9 |
| Literature: Hahn,R.C. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 3404 - 3415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Cyclobutyl-nitrobenzol |
| 4-Nitro-phenyl-cyclobutan |
| Benzene,1-cyclobutyl-4-nitro |