AKOS B028905 structure
|
Common Name | AKOS B028905 | ||
|---|---|---|---|---|
| CAS Number | 692268-01-2 | Molecular Weight | 240.68300 | |
| Density | 1.17g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 2-chloro-5-ethoxy-4-prop-2-enoxybenzaldehyde |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.68300 |
| Flash Point | 144.4ºC |
| Exact Mass | 240.05500 |
| PSA | 35.53000 |
| LogP | 3.11600 |
| Index of Refraction | 1.543 |
| InChIKey | GRKKQNMAJYLASY-UHFFFAOYSA-N |
| SMILES | C=CCOc1cc(Cl)c(C=O)cc1OCC |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |