AKOS B028998
Modify Date: 2025-08-25 14:57:29
AKOS B028998 structure
|
Common Name | AKOS B028998 | ||
|---|---|---|---|---|
| CAS Number | 692281-56-4 | Molecular Weight | 233.09100 | |
| Density | 1.277g/cm3 | Boiling Point | 316.8ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.2ºC | |
| Name | 3,5-dichloro-4-propan-2-yloxybenzaldehyde |
|---|
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 316.8ºC at 760 mmHg |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09100 |
| Flash Point | 131.2ºC |
| Exact Mass | 232.00600 |
| PSA | 26.30000 |
| LogP | 3.59310 |
| Index of Refraction | 1.556 |
| InChIKey | ZSUPYLWHFXVVDP-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1c(Cl)cc(C=O)cc1Cl |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |