sodium 2-[ethyl(3-methylphenyl)amino]ethanesulphonate structure
|
Common Name | sodium 2-[ethyl(3-methylphenyl)amino]ethanesulphonate | ||
|---|---|---|---|---|
| CAS Number | 6923-65-5 | Molecular Weight | 265.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16NNaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-(N-ethyl-3-methylanilino)ethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16NNaO3S |
|---|---|
| Molecular Weight | 265.30400 |
| Exact Mass | 265.07500 |
| PSA | 68.82000 |
| LogP | 2.44730 |
| InChIKey | UGVDMCBCPTXLJB-UHFFFAOYSA-M |
| SMILES | CCN(CCS(=O)(=O)[O-])c1cccc(C)c1.[Na+] |
|
~%
sodium 2-[ethyl... CAS#:6923-65-5 |
| Literature: Tong; Glesmann Journal of the American Chemical Society, 1956 , vol. 78, p. 5827 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| einecs 230-044-8 |