2-amino-3,4,5,6-tetrachlorobenzoic acid structure
|
Common Name | 2-amino-3,4,5,6-tetrachlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6923-69-9 | Molecular Weight | 274.91600 | |
| Density | 1.808g/cm3 | Boiling Point | 404.6ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 2-amino-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.808g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760 mmHg |
| Molecular Formula | C7H3Cl4NO2 |
| Molecular Weight | 274.91600 |
| Flash Point | 198.5ºC |
| Exact Mass | 272.89200 |
| PSA | 63.32000 |
| LogP | 4.16180 |
| Index of Refraction | 1.673 |
| InChIKey | CJKYKXAESHUOOV-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2-amino-3,4,5,6... CAS#:6923-69-9 |
| Literature: Villiger; Blangey Chemische Berichte, 1909 , vol. 42, p. 3552 |
|
~%
2-amino-3,4,5,6... CAS#:6923-69-9 |
| Literature: Tust Chemische Berichte, 1887 , vol. 20, p. 2441 |
|
~%
2-amino-3,4,5,6... CAS#:6923-69-9 |
| Literature: Tust Chemische Berichte, 1887 , vol. 20, p. 2441 |
|
~%
2-amino-3,4,5,6... CAS#:6923-69-9 |
| Literature: Tust Chemische Berichte, 1887 , vol. 20, p. 2441 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| tetrachloroanthranilic acid |
| 2-amino-3,4,5,6-tetrachloro-benzoic acid |
| 3,4,5,6-tetrachloranthranilic acid |
| Tetrachloranthranilsaeure |
| 3.4.5.6-Tetrachlor-anthranilsaeure |
| 2-Amino-3,4,5,6-tetrachlor-benzoesaeure |