3,5-Dibromo-4-(isooctyloxy)benzonitrile
Modify Date: 2025-10-11 05:12:39
3,5-Dibromo-4-(isooctyloxy)benzonitrile structure
|
Common Name | 3,5-Dibromo-4-(isooctyloxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 69237-07-6 | Molecular Weight | 389.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dibromo-4-(isooctyloxy)benzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19Br2NO |
|---|---|
| Molecular Weight | 389.12 |
| InChIKey | HLSPLHBMMHDJGI-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCOc1c(Br)cc(C#N)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: InChIKey of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is HLSPLHBMMHDJGI-UHFFFAOYSA-N. |
| Q: What is the English name of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: The English name of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is 3,5-Dibromo-4-(isooctyloxy)benzonitrile. |
| Q: What is the Chinese name of 69237-07-6? |
| A: Chinese name of 69237-07-6 is 69237-07-6. |
| Q: What is the SMILES notation of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: SMILES notation of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is CC(C)CCCCCOc1c(Br)cc(C#N)cc1Br. |
| Q: What is the molecular weight of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: Molecular weight of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is 389.12. |
| Q: What is the molecular formula of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: Molecular formula of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is C15H19Br2NO. |
| Q: What is the CAS number of 3,5-Dibromo-4-(isooctyloxy)benzonitrile? |
| A: CAS number of 3,5-Dibromo-4-(isooctyloxy)benzonitrile is 69237-07-6. |