3-Methoxy-O-methyl-L-tyrosine hydrochloride (1:1) structure
|
Common Name | 3-Methoxy-O-methyl-L-tyrosine hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 69274-24-4 | Molecular Weight | 261.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methoxy-O-methyl-L-tyrosine hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16ClNO4 |
|---|---|
| Molecular Weight | 261.70200 |
| Exact Mass | 261.07700 |
| PSA | 81.78000 |
| LogP | 2.16050 |
| InChIKey | KRIFQZYWLFOKRA-QRPNPIFTSA-N |
| SMILES | COc1ccc(CC(N)C(=O)O)cc1OC.Cl |
| HS Code | 2922509090 |
|---|
|
~98%
3-Methoxy-O-met... CAS#:69274-24-4 |
| Literature: Occidental Chemical Corporation Patent: US4912221 A1, 1990 ; |
|
~%
3-Methoxy-O-met... CAS#:69274-24-4 |
| Literature: O'Reilly; Derwin; Lin Synthesis, 1990 , # 7 p. 550 - 556 |
|
~%
3-Methoxy-O-met... CAS#:69274-24-4 |
| Literature: O'Reilly; Derwin; Lin Synthesis, 1990 , # 7 p. 550 - 556 |
|
~%
3-Methoxy-O-met... CAS#:69274-24-4 |
| Literature: O'Reilly; Derwin; Lin Synthesis, 1990 , # 7 p. 550 - 556 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-3,4-dimethoxyphenylalanine hydrochloride |
| 3-thienylalanine |
| RARECHEM BK PT 0215 |
| 3-Thein-3-yl-L-alanine |
| 3-Thien-3-yl-L-alanine |