4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine] structure
|
Common Name | 4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine] | ||
|---|---|---|---|---|
| CAS Number | 69293-81-8 | Molecular Weight | 548.64000 | |
| Density | 1.23g/cm3 | Boiling Point | 812.1ºC at 760 mmHg | |
| Molecular Formula | C34H28N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 445ºC | |
| Name | N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 812.1ºC at 760 mmHg |
| Molecular Formula | C34H28N8 |
| Molecular Weight | 548.64000 |
| Flash Point | 445ºC |
| Exact Mass | 548.24400 |
| PSA | 98.22000 |
| LogP | 11.46860 |
| Index of Refraction | 1.681 |
| InChIKey | JPFUMXSFWSRJQY-UHFFFAOYSA-N |
| SMILES | CNc1ccc(N=Nc2ccc(N=Nc3ccc(N=Nc4ccc(NC)c5ccccc45)cc3)cc2)c2ccccc12 |
|
~%
4,4'-[Azobis(4,... CAS#:69293-81-8 |
| Literature: Aftergut, S.; Cole, H. S. Molecular Crystals and Liquid Crystals (1969-1991), 1990 , vol. 188, # l p. 147 - 153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |