4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine]
![4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine] Structure](https://image.chemsrc.com/caspic/112/69293-81-8.png)
4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine] structure
|
Common Name | 4,4'-[Azobis(4,1-phenyleneazo)]bis[N-methyl-1-naphthalenamine] | ||
|---|---|---|---|---|
| CAS Number | 69293-81-8 | Molecular Weight | 548.64000 | |
| Density | 1.23g/cm3 | Boiling Point | 812.1ºC at 760 mmHg | |
| Molecular Formula | C34H28N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 445ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 812.1ºC at 760 mmHg |
| Molecular Formula | C34H28N8 |
| Molecular Weight | 548.64000 |
| Flash Point | 445ºC |
| Exact Mass | 548.24400 |
| PSA | 98.22000 |
| LogP | 11.46860 |
| Index of Refraction | 1.681 |
| InChIKey | JPFUMXSFWSRJQY-UHFFFAOYSA-N |
| SMILES | CNc1ccc(N=Nc2ccc(N=Nc3ccc(N=Nc4ccc(NC)c5ccccc45)cc3)cc2)c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4,4'-[Azobis(4,... CAS#:69293-81-8 |
| Literature: Aftergut, S.; Cole, H. S. Molecular Crystals and Liquid Crystals (1969-1991), 1990 , vol. 188, # l p. 147 - 153 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: InChIKey of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is JPFUMXSFWSRJQY-UHFFFAOYSA-N. |
| Q: What is the English name of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: The English name of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine. |
| Q: What is the LogP of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: LogP of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is 11.46860. |
| Q: What is the molecular formula of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: Molecular formula of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is C34H28N8. |
| Q: What is the boiling point of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: Boiling point of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is 812.1ºC at 760 mmHg. |
| Q: What is the CAS number of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: CAS number of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is 69293-81-8. |
| Q: What is the molecular weight of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: Molecular weight of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is 548.64000. |
| Q: What is the polar surface area (PSA) of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: Polar surface area (PSA) of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine is 98.22000. |
| Q: What is the Chinese name of 69293-81-8? |
| A: Chinese name of 69293-81-8 is 69293-81-8. |
| Q: What are the upstream materials of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine? |
| A: Related upstream materials(CAS) of N-methyl-4-[[4-[[4-[[4-(methylamino)naphthalen-1-yl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-amine: 2216-68-4;538-41-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |