1,3,3,5,5-pentamethyl-1,3,5-azadisilinane structure
|
Common Name | 1,3,3,5,5-pentamethyl-1,3,5-azadisilinane | ||
|---|---|---|---|---|
| CAS Number | 69320-68-9 | Molecular Weight | 187.43000 | |
| Density | 0.85g/cm3 | Boiling Point | 193.6ºC at 760 mmHg | |
| Molecular Formula | C8H21NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.9ºC | |
| Name | 1,3,3,5,5-pentamethyl-1,3,5-azadisilinane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.85g/cm3 |
|---|---|
| Boiling Point | 193.6ºC at 760 mmHg |
| Molecular Formula | C8H21NSi2 |
| Molecular Weight | 187.43000 |
| Flash Point | 70.9ºC |
| Exact Mass | 187.12100 |
| PSA | 3.24000 |
| LogP | 2.74070 |
| Index of Refraction | 1.443 |
| InChIKey | FTWWWHUTSLAILC-UHFFFAOYSA-N |
| SMILES | CN1C[Si](C)(C)C[Si](C)(C)C1 |
|
~%
1,3,3,5,5-penta... CAS#:69320-68-9 |
| Literature: Bock,H. et al. Journal of Organometallic Chemistry, 1979 , vol. 164, p. 295 - 304 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Aza-3,5-disilacyclohexane,1,3,3,5,5-pentamethyl |
| 1,3,3,5,5-Pentamethyl-3,5-disila-1-azacyclohexan |