2-Methoxy-9H-carbazole structure
|
Common Name | 2-Methoxy-9H-carbazole | ||
|---|---|---|---|---|
| CAS Number | 6933-49-9 | Molecular Weight | 197.232 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 392.2±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO | Melting Point | 239℃ | |
| MSDS | N/A | Flash Point | 142.4±10.6 °C | |
| Name | 2-methoxy-9h-carbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.2±15.0 °C at 760 mmHg |
| Melting Point | 239℃ |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.232 |
| Flash Point | 142.4±10.6 °C |
| Exact Mass | 197.084061 |
| PSA | 25.02000 |
| LogP | 3.63 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | MDKVPSJRUXOFFV-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of human C-terminally His6-tagged microtubule-activated KSP motor domain A...
Source: ChEMBL
Target: Kinesin-like protein KIF11
External Id: CHEMBL1177081
|
| 2-Methoxy-carbazol |
| 2-Methoxy-9H-carbazole |
| 2-methoxy-carbazole |