2-hydroxy-4-phenylmethoxycarbonylamino-benzoic acid structure
|
Common Name | 2-hydroxy-4-phenylmethoxycarbonylamino-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6935-15-5 | Molecular Weight | 287.26700 | |
| Density | 1.432g/cm3 | Boiling Point | 450.3ºC at 760 mmHg | |
| Molecular Formula | C15H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.2ºC | |
| Name | 2-hydroxy-4-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 450.3ºC at 760 mmHg |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.26700 |
| Flash Point | 226.2ºC |
| Exact Mass | 287.07900 |
| PSA | 95.86000 |
| LogP | 2.91210 |
| Index of Refraction | 1.677 |
| InChIKey | YCGSSGSFSHXDCV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~68%
2-hydroxy-4-phe... CAS#:6935-15-5 |
| Literature: APPLIED RESEARCH SYSTEMS ARS HOLDING N.V. Patent: WO2006/125805 A1, 2006 ; Location in patent: Page/Page column 58 ; |
|
~99%
2-hydroxy-4-phe... CAS#:6935-15-5 |
| Literature: Terai, Takuya; Ito, Hiroki; Kikuchi, Kazuya; Nagano, Tetsuo Chemistry - A European Journal, 2012 , vol. 18, # 24 p. 7377 - 7381 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-benzyloxycarbonylaminosalicylic acid |
| 4-Benzyloxycarbonylamino-2-hydroxy-benzoesaeure |