[2,5-dibromo-3,6-bis(3-bromo-2,4,6-trimethyl-phenyl)-4-[2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetyl]oxy-phenyl] 2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetate structure
|
Common Name | [2,5-dibromo-3,6-bis(3-bromo-2,4,6-trimethyl-phenyl)-4-[2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetyl]oxy-phenyl] 2-[(1R,2S,5R)-5-methyl-2-propan-2-yl-cyclohexyl]oxyacetate | ||
|---|---|---|---|---|
| CAS Number | 6935-91-7 | Molecular Weight | 1054.62000 | |
| Density | 1.45g/cm3 | Boiling Point | 831.6ºC at 760 mmHg | |
| Molecular Formula | C48H62Br4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 456.7ºC | |
| Name | [2,5-dibromo-3,6-bis(3-bromo-2,4,6-trimethylphenyl)-4-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetyl]oxyphenyl] 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 831.6ºC at 760 mmHg |
| Molecular Formula | C48H62Br4O6 |
| Molecular Weight | 1054.62000 |
| Flash Point | 456.7ºC |
| Exact Mass | 1050.13000 |
| PSA | 71.06000 |
| LogP | 14.68660 |
| Index of Refraction | 1.603 |
| InChIKey | KMJLXYLRUQCELA-UNOCMMMMSA-N |
| SMILES | Cc1cc(C)c(-c2c(Br)c(OC(=O)COC3CC(C)CCC3C(C)C)c(-c3c(C)cc(C)c(Br)c3C)c(Br)c2OC(=O)COC2CC(C)CCC2C(C)C)c(C)c1Br |
|
~%
[2,5-dibromo-3,... CAS#:6935-91-7 |
| Literature: Knauf; Shildneck; Adams Journal of the American Chemical Society, 1934 , vol. 56, p. 2109 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3',5-Tri-tert-butyl-diaziridino-<1',2':1,2>-1,2,4-triazolidin |
| 2,4,6-Tri-t-butyl-1,3,5-triaza-bicyclo<3.1.0>hexan |