3-(p-Chloro-α-methylbenzyl)carbazic acid ethyl ester structure
|
Common Name | 3-(p-Chloro-α-methylbenzyl)carbazic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 69353-13-5 | Molecular Weight | 242.70200 | |
| Density | 1.18g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[1-(4-chlorophenyl)ethylamino]carbamate |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.70200 |
| Exact Mass | 242.08200 |
| PSA | 53.85000 |
| LogP | 3.24700 |
| Index of Refraction | 1.53 |
| InChIKey | FUDNZWLAFXGUSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNC(C)c1ccc(Cl)cc1 |
|
~%
3-(p-Chloro-α-m... CAS#:69353-13-5 |
| Literature: Anderson,F.E. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, # 2 p. 221 - 230 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |