3-(p-Methoxy-α-methylbenzyl)carbazic acid ethyl ester structure
|
Common Name | 3-(p-Methoxy-α-methylbenzyl)carbazic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 69353-15-7 | Molecular Weight | 238.28300 | |
| Density | 1.094g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[1-(4-methoxyphenyl)ethylamino]carbamate |
|---|
| Density | 1.094g/cm3 |
|---|---|
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.28300 |
| Exact Mass | 238.13200 |
| PSA | 63.08000 |
| LogP | 2.60220 |
| Index of Refraction | 1.512 |
| InChIKey | XXWXKVWOGOPGGM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NNC(C)c1ccc(OC)cc1 |
|
~%
3-(p-Methoxy-α-... CAS#:69353-15-7 |
| Literature: Anderson,F.E. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, # 2 p. 221 - 230 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |