D-Galactose,(aminocarbonyl)hydrazone (9CI)
Modify Date: 2025-09-18 17:33:36
D-Galactose,(aminocarbonyl)hydrazone (9CI) structure
|
Common Name | D-Galactose,(aminocarbonyl)hydrazone (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6936-69-2 | Molecular Weight | 237.21000 | |
| Density | 1.754g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,4,5,6-pentahydroxyhexylideneamino)urea |
|---|
| Density | 1.754g/cm3 |
|---|---|
| Molecular Formula | C7H15N3O6 |
| Molecular Weight | 237.21000 |
| Exact Mass | 237.09600 |
| PSA | 168.63000 |
| Index of Refraction | 1.627 |
| InChIKey | NOUQGOYNEGWDCZ-XLUWADSXSA-N |
| SMILES | NC(=O)NN=CC(O)C(O)C(O)C(O)CO |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |