1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone
1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone structure
|
Common Name | 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 69366-27-4 | Molecular Weight | 214.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O |
|---|---|
| Molecular Weight | 214.30300 |
| Exact Mass | 214.13600 |
| PSA | 17.07000 |
| LogP | 3.84920 |
| InChIKey | RRJJMGBWBYUIIO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(C)CC=C(c2ccccc2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
1-(1-methyl-4-p... CAS#:69366-27-4 |
| Literature: Fujiwara, Tooru; Takeda, Takeshi Tetrahedron Letters, 1990 , vol. 31, # 42 p. 6027 - 6030 |
|
~87%
1-(1-methyl-4-p... CAS#:69366-27-4 |
| Literature: Gupta, Ratna Das; Brindaban, Ranu C.; Ghatak, Ushua Ranjan Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 619 - 620 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:88522-10-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: Molecular weight of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is 214.30300. |
| Q: What is the InChIKey of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: InChIKey of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is RRJJMGBWBYUIIO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: CAS number of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is 69366-27-4. |
| Q: What is the LogP of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: LogP of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is 3.84920. |
| Q: What are the upstream materials of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: Related upstream materials(CAS) of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone: 35227-78-2;88522-08-1. |
| Q: What is the molecular formula of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: Molecular formula of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is C15H18O. |
| Q: What is the SMILES notation of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: SMILES notation of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is CC(=O)C1(C)CC=C(c2ccccc2)CC1. |
| Q: What are the downstream products of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: Related downstream products(CAS) of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone: 88522-10-5. |
| Q: What is the English name of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone? |
| A: The English name of 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone is 1-(1-methyl-4-phenylcyclohex-3-en-1-yl)ethanone. |
| Q: What is the Chinese name of 69366-27-4? |
| A: Chinese name of 69366-27-4 is 69366-27-4. |