[2,2'-Binaphthalene]-1,1',6,6',7,7'-hexol,8,8'-bis[[[(4-bromophenyl)methyl]imino]methyl]-3,3'-dimethyl-5,5'-bis(1-methylethyl)- structure
|
Common Name | [2,2'-Binaphthalene]-1,1',6,6',7,7'-hexol,8,8'-bis[[[(4-bromophenyl)methyl]imino]methyl]-3,3'-dimethyl-5,5'-bis(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6937-20-8 | Molecular Weight | 854.62200 | |
| Density | 1.544g/cm3 | Boiling Point | 974ºC at 760 mmHg | |
| Molecular Formula | C44H42Br2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 542.8ºC | |
| Name | (1Z)-1-[[(4-bromophenyl)methylamino]methylidene]-7-[(8Z)-8-[[(4-bromophenyl)methylamino]methylidene]-1,6-dihydroxy-3-methyl-7-oxo-5-propan-2-ylnaphthalen-2-yl]-3,8-dihydroxy-6-methyl-4-propan-2-ylnaphthalen-2-one |
|---|
| Density | 1.544g/cm3 |
|---|---|
| Boiling Point | 974ºC at 760 mmHg |
| Molecular Formula | C44H42Br2N2O6 |
| Molecular Weight | 854.62200 |
| Flash Point | 542.8ºC |
| Exact Mass | 852.14100 |
| PSA | 146.10000 |
| LogP | 11.52040 |
| Index of Refraction | 1.732 |
| InChIKey | WCWIOEJECWKTEQ-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(C=NCc3ccc(Br)cc3)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=NCc3ccc(Br)cc3)c2c1O |
|
~%
[2,2'-Binaphtha... CAS#:6937-20-8 |
| Literature: Alley; Shirley Journal of Organic Chemistry, 1959 , vol. 24, p. 1534 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |