18-(3-amino-benzoyloxy)-11,17-dimethoxy-yohimbane-16-carboxylic acid methyl ester structure
|
Common Name | 18-(3-amino-benzoyloxy)-11,17-dimethoxy-yohimbane-16-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6937-99-1 | Molecular Weight | 533.61500 | |
| Density | 1.34g/cm3 | Boiling Point | 720ºC at 760 mmHg | |
| Molecular Formula | C30H35N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.2ºC | |
| Name | 18-(3-amino-benzoyloxy)-11,17-dimethoxy-yohimbane-16-carboxylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 720ºC at 760 mmHg |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.61500 |
| Flash Point | 389.2ºC |
| Exact Mass | 533.25300 |
| PSA | 116.11000 |
| LogP | 4.24660 |
| Index of Refraction | 1.654 |
| InChIKey | RZJORDLTBFBRBO-FZAZYMOWSA-N |
| SMILES | COC(=O)C1C2CC3c4[nH]c5cc(OC)ccc5c4CCN3CC2CC(OC(=O)c2ccc(N)cc2)C1OC |
|
~%
18-(3-amino-ben... CAS#:6937-99-1 |
| Literature: Lucas et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 1928,1931,1932 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 18-(3-dimethylamino-benzoyloxy)-11,17-dimethoxy-yohimbane-16-carboxylic acid methyl ester |
| Methyl-O-(3-dimethylaminobenzoyl)reserpat |
| 18-(4-amino-benzoyloxy)-11,17-dimethoxy-yohimbane-16-carboxylic acid methyl ester |
| Methyl-O-(3-aminobenzoyl)reserpat |
| Methyl-O-(4-aminobenzoyl)reserpat |
| Kauren-15-ol-17 |