[[4-(2-chlorobenzoyl)diazenylphenyl]amino] 4-methoxybenzoate structure
|
Common Name | [[4-(2-chlorobenzoyl)diazenylphenyl]amino] 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 6938-73-4 | Molecular Weight | 237.60600 | |
| Density | 1.3g/cm3 | Boiling Point | 571.9ºC at 760 mmHg | |
| Molecular Formula | C9H7ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.7ºC | |
| Name | Phenol,2-chloro-5-methyl-,acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 571.9ºC at 760 mmHg |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.60600 |
| Flash Point | 299.7ºC |
| Exact Mass | 237.01700 |
| PSA | 29.10000 |
| LogP | 3.39020 |
| Index of Refraction | 1.613 |
| InChIKey | KQBBIJPLOXRSLZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Chlor-3-acetoxy-toluol |