1-tert-butyl 4-Methyl 4-(2-oxoethyl)piperidine-1,4-dicarboxylate structure
|
Common Name | 1-tert-butyl 4-Methyl 4-(2-oxoethyl)piperidine-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 693824-61-2 | Molecular Weight | 285.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-O-tert-butyl 4-O-methyl 4-(2-oxoethyl)piperidine-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23NO5 |
|---|---|
| Molecular Weight | 285.33600 |
| Exact Mass | 285.15800 |
| PSA | 72.91000 |
| LogP | 1.70360 |
| InChIKey | GIDJEIWZWPXTDQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC=O)CCN(C(=O)OC(C)(C)C)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
1-tert-butyl 4-... CAS#:693824-61-2 |
| Literature: MERCK and CO., INC. Patent: WO2006/41830 A2, 2006 ; Location in patent: Page/Page column 56 ; WO 2006/041830 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butyl-4-methyl-4-(2-oxoethyl)piperidine-1,4-dicarboxylate |