Phenol,2,3,5,6-tetrachloro-4-nitro-, acetate (ester) (9CI) structure
|
Common Name | Phenol,2,3,5,6-tetrachloro-4-nitro-, acetate (ester) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6939-70-4 | Molecular Weight | 318.92600 | |
| Density | 1.708g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl4NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.9ºC | |
| Name | (2,3,5,6-tetrachloro-4-nitrophenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C8H3Cl4NO4 |
| Molecular Weight | 318.92600 |
| Flash Point | 198.9ºC |
| Exact Mass | 316.88200 |
| PSA | 72.12000 |
| LogP | 4.65690 |
| Index of Refraction | 1.598 |
| InChIKey | RIALXPIBDSOWAX-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(Cl)c(Cl)c([N+](=O)[O-])c(Cl)c1Cl |
|
~%
Phenol,2,3,5,6-... CAS#:6939-70-4 |
| Literature: Peters; Rowe; Stead Journal of the Chemical Society, 1943 , p. 233 |
|
~%
Phenol,2,3,5,6-... CAS#:6939-70-4 |
| Literature: Peters; Rowe; Stead Journal of the Chemical Society, 1943 , p. 233 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3,5,6-tetrachloro-4-nitrophenyl acetate |
| 2.3.5.6-Tetrachlor-4-nitro-1-acetoxy-benzol |