N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide structure
|
Common Name | N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 69392-32-1 | Molecular Weight | 281.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-hydroxyphenyl)-2-(trifluoromethyl)benzamide |
|---|
| Molecular Formula | C14H10F3NO2 |
|---|---|
| Molecular Weight | 281.23000 |
| Exact Mass | 281.06600 |
| PSA | 52.82000 |
| LogP | 4.04730 |
| InChIKey | YUWVGNPIDBYWEW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(O)c1)c1ccccc1C(F)(F)F |
|
~%
N-(3-hydroxyphe... CAS#:69392-32-1 |
| Literature: Tsao, Rong; Eto, Morifusa Agricultural and Biological Chemistry, 1991 , vol. 55, # 3 p. 763 - 768 |
|
~%
N-(3-hydroxyphe... CAS#:69392-32-1 |
| Literature: Tsao, Rong; Eto, Morifusa Agricultural and Biological Chemistry, 1991 , vol. 55, # 3 p. 763 - 768 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |