{1H-Benz[de]isoquinoline-1,3(2H)-dione,} {5-amino-2-[2-(1-pyrrolidinyl)ethyl]-} structure
|
Common Name | {1H-Benz[de]isoquinoline-1,3(2H)-dione,} {5-amino-2-[2-(1-pyrrolidinyl)ethyl]-} | ||
|---|---|---|---|---|
| CAS Number | 69408-83-9 | Molecular Weight | 309.36200 | |
| Density | 1.331g/cm3 | Boiling Point | 551.4ºC at 760 mmHg | |
| Molecular Formula | C18H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.2ºC | |
| Name | 5-amino-2-(2-pyrrolidin-1-ylethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 551.4ºC at 760 mmHg |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.36200 |
| Flash Point | 287.2ºC |
| Exact Mass | 309.14800 |
| PSA | 68.33000 |
| LogP | 2.14980 |
| Index of Refraction | 1.692 |
| InChIKey | TXYIFVDECCPRPY-UHFFFAOYSA-N |
| SMILES | Nc1cc2c3c(cccc3c1)C(=O)N(CCN1CCCC1)C2=O |
|
~%
{1H-Benz[de]iso... CAS#:69408-83-9 |
| Literature: Fernandez Brana; Martinez Sanz; Castellano; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 3 p. 207 - 212 |
|
~78%
{1H-Benz[de]iso... CAS#:69408-83-9 |
| Literature: Fernandez Brana; Martinez Sanz; Castellano; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 3 p. 207 - 212 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hms2853d21 |