LysoFP-NH2 structure
|
Common Name | LysoFP-NH2 | ||
|---|---|---|---|---|
| CAS Number | 69408-85-1 | Molecular Weight | 325.362 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 577.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.3±28.7 °C | |
Use of LysoFP-NH2LysoFP-NH2 is the fluorescent form of the lysosomal turn-on fluorescent probe for carbon monoxide (CO) lysoFP-NO2. LysoFP-NH2 is formed when lysoFP-NO2 reacts with CO. It displays excitation/emission maxima of 440/528 nm, respectively. |
| Name | LysoFP-NH2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.9±45.0 °C at 760 mmHg |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.362 |
| Flash Point | 303.3±28.7 °C |
| Exact Mass | 325.142639 |
| LogP | -0.34 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | JYKPDVFVKOXSSF-UHFFFAOYSA-N |
| SMILES | Nc1cc2c3c(cccc3c1)C(=O)N(CCN1CCOCC1)C2=O |
| 5-Amino-2-[2-(4-morpholinyl)ethyl]-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| 1H-Benz[de]isoquinoline-1,3(2H)-dione, 5-amino-2-[2-(4-morpholinyl)ethyl]- |
| LysoFP-NH2 |