(2R)-2-(4-tert-butylphenoxy)propanoate structure
|
Common Name | (2R)-2-(4-tert-butylphenoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 6941-12-4 | Molecular Weight | 222.28000 | |
| Density | N/A | Boiling Point | 334ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121ºC | |
| Name | 2-(4-tert-butylphenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 334ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 121ºC |
| Exact Mass | 222.12600 |
| PSA | 46.53000 |
| LogP | 2.83600 |
| InChIKey | DMJZZNRMJJGRNF-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
(2R)-2-(4-tert-... CAS#:6941-12-4 |
| Literature: Gualtieri; Bottalico; Calandrella; Dei; Giovannoni; Mealli; Romanelli; Scapecchi; Teodori; Galeotti; Ghelardini; Giotti; Bartolini Journal of Medicinal Chemistry, 1994 , vol. 37, # 11 p. 1712 - 1719 |
|
~%
(2R)-2-(4-tert-... CAS#:6941-12-4 |
| Literature: Eastman Kodak Co. Patent: US2423730 , 1944 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[4-(1,1-dimethylethyl)phenoxy]-propanoic acid |
| 2-(p-tert-butylphenoxy)propionic acid |
| 2-(4-tert-Butyl-phenoxy)-propionsaeure |
| 2-(3,4-DIMETHOXY-PHENYL)-IMIDAZO[1,2-A]PYRIDINE-3 |
| 2-(4-t-Butylphenoxy)propionic acid |
| 2-(4-tert-butyl-phenoxy)-propionic acid |
| O-(4-tert.-Butyl-phenyl)-DL-milchsaeure |
| 2-[4-(tert-butyl)phenoxy]propanoic acid |